C56H56N2 — CID 58232451
4,11-ditert-butyl-6,6,12,12-tetramethyl-2-N,2-N,8-N,8-N-tetraphenylindeno[1,2-b]fluorene-2,8-diamine (PubChem CID 58232451) has the molecular formula C56H56N2 and a molecular weight of 757.08 g/mol. Its IUPAC name is 4,11-ditert-butyl-6,6,12,12-tetramethyl-2-N,2-N,8-N,8-N-tetraphenylindeno[1,2-b]fluorene-2,8-diamine.
| Compound Name | 4,11-ditert-butyl-6,6,12,12-tetramethyl-2-N,2-N,8-N,8-N-tetraphenylindeno[1,2-b]fluorene-2,8-diamine |
|---|---|
| PubChem CID | 58232451 |
| Molecular Formula | C56H56N2 |
| Molecular Weight | 757.08 g/mol |
| Exact Mass | 756.44 |
| IUPAC Name | 4,11-ditert-butyl-6,6,12,12-tetramethyl-2-N,2-N,8-N,8-N-tetraphenylindeno[1,2-b]fluorene-2,8-diamine |
| SMILES | CC(C)(C)c1cc(N(c2ccccc2)c2ccccc2)cc2c1-c1cc3c(c(C(C)(C)C)c1C2(C)C)-c1ccc(N(c2ccccc2)c2ccccc2)cc1C3(C)C |
| InChI | InChI=1S/C56H56N2/c1-53(2,3)46-34-42(58(39-27-19-13-20-28-39)40-29-21-14-22-30-40)35-47-49(46)44-36-48-50(52(54(4,5)6)51(44)56(47,9)10)43-32-31-41(33-45(43)55(48,7)8)57(37-23-15-11-16-24-37)38-25-17-12-18-26-38/h11-36H,1-10H3 |
| InChIKey | JJVDGBFIPLHAFE-UHFFFAOYSA-N |
| XLogP | 15.83 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 757.08 |
| LogP ≤ 5 | 15.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |