C54H52N2 — CID 58232463
4,6,6,10,12,12-hexamethyl-2-N,8-N-bis(2-methylphenyl)-2-N,8-N-bis(3-methylphenyl)indeno[1,2-b]fluorene-2,8-diamine (PubChem CID 58232463) has the molecular formula C54H52N2 and a molecular weight of 729.02 g/mol. Its IUPAC name is 4,6,6,10,12,12-hexamethyl-2-N,8-N-bis(2-methylphenyl)-2-N,8-N-bis(3-methylphenyl)indeno[1,2-b]fluorene-2,8-diamine.
| Compound Name | 4,6,6,10,12,12-hexamethyl-2-N,8-N-bis(2-methylphenyl)-2-N,8-N-bis(3-methylphenyl)indeno[1,2-b]fluorene-2,8-diamine |
|---|---|
| PubChem CID | 58232463 |
| Molecular Formula | C54H52N2 |
| Molecular Weight | 729.02 g/mol |
| Exact Mass | 728.41 |
| IUPAC Name | 4,6,6,10,12,12-hexamethyl-2-N,8-N-bis(2-methylphenyl)-2-N,8-N-bis(3-methylphenyl)indeno[1,2-b]fluorene-2,8-diamine |
| SMILES | Cc1cccc(N(c2cc(C)c3c(c2)C(C)(C)c2cc4c(cc2-3)C(C)(C)c2cc(N(c3cccc(C)c3)c3ccccc3C)cc(C)c2-4)c2ccccc2C)c1 |
| InChI | InChI=1S/C54H52N2/c1-33-17-15-21-39(25-33)55(49-23-13-11-19-35(49)3)41-27-37(5)51-43-31-46-44(32-45(43)53(7,8)47(51)29-41)52-38(6)28-42(30-48(52)54(46,9)10)56(40-22-16-18-34(2)26-40)50-24-14-12-20-36(50)4/h11-32H,1-10H3 |
| InChIKey | JYIDXQADBJCNAX-UHFFFAOYSA-N |
| XLogP | 15.09 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.02 |
| LogP ≤ 5 | 15.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |