C58H52N2S2 — CID 58232469
2-N,9-N-bis(1-benzothiophen-3-yl)-2-N,9-N-bis(3,5-dimethylphenyl)-4,7,11,11,12,12-hexamethylindeno[2,1-a]fluorene-2,9-diamine (PubChem CID 58232469) has the molecular formula C58H52N2S2 and a molecular weight of 841.20 g/mol. Its IUPAC name is 2-N,9-N-bis(1-benzothiophen-3-yl)-2-N,9-N-bis(3,5-dimethylphenyl)-4,7,11,11,12,12-hexamethylindeno[2,1-a]fluorene-2,9-diamine.
| Compound Name | 2-N,9-N-bis(1-benzothiophen-3-yl)-2-N,9-N-bis(3,5-dimethylphenyl)-4,7,11,11,12,12-hexamethylindeno[2,1-a]fluorene-2,9-diamine |
|---|---|
| PubChem CID | 58232469 |
| Molecular Formula | C58H52N2S2 |
| Molecular Weight | 841.20 g/mol |
| Exact Mass | 840.36 |
| IUPAC Name | 2-N,9-N-bis(1-benzothiophen-3-yl)-2-N,9-N-bis(3,5-dimethylphenyl)-4,7,11,11,12,12-hexamethylindeno[2,1-a]fluorene-2,9-diamine |
| SMILES | Cc1cc(C)cc(N(c2cc(C)c3c(c2)C(C)(C)c2c-3ccc3c2C(C)(C)c2cc(N(c4cc(C)cc(C)c4)c4csc5ccccc45)cc(C)c2-3)c2csc3ccccc23)c1 |
| InChI | InChI=1S/C58H52N2S2/c1-33-21-34(2)24-39(23-33)59(49-31-61-51-17-13-11-15-43(49)51)41-27-37(5)53-45-19-20-46-54-38(6)28-42(30-48(54)58(9,10)56(46)55(45)57(7,8)47(53)29-41)60(40-25-35(3)22-36(4)26-40)50-32-62-52-18-14-12-16-44(50)52/h11-32H,1-10H3 |
| InChIKey | SXVPPIVURIDEGI-UHFFFAOYSA-N |
| XLogP | 17.52 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 841.20 |
| LogP ≤ 5 | 17.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |