C58H60N2 — CID 58232252
2-N,2-N,8-N,8-N-tetrakis(3,4-dimethylphenyl)-4,6,6,10,12,12-hexamethylindeno[1,2-b]fluorene-2,8-diamine (PubChem CID 58232252) has the molecular formula C58H60N2 and a molecular weight of 785.13 g/mol. Its IUPAC name is 2-N,2-N,8-N,8-N-tetrakis(3,4-dimethylphenyl)-4,6,6,10,12,12-hexamethylindeno[1,2-b]fluorene-2,8-diamine.
| Compound Name | 2-N,2-N,8-N,8-N-tetrakis(3,4-dimethylphenyl)-4,6,6,10,12,12-hexamethylindeno[1,2-b]fluorene-2,8-diamine |
|---|---|
| PubChem CID | 58232252 |
| Molecular Formula | C58H60N2 |
| Molecular Weight | 785.13 g/mol |
| Exact Mass | 784.48 |
| IUPAC Name | 2-N,2-N,8-N,8-N-tetrakis(3,4-dimethylphenyl)-4,6,6,10,12,12-hexamethylindeno[1,2-b]fluorene-2,8-diamine |
| SMILES | Cc1ccc(N(c2ccc(C)c(C)c2)c2cc(C)c3c(c2)C(C)(C)c2cc4c(cc2-3)C(C)(C)c2cc(N(c3ccc(C)c(C)c3)c3ccc(C)c(C)c3)cc(C)c2-4)cc1C |
| InChI | InChI=1S/C58H60N2/c1-33-15-19-43(23-37(33)5)59(44-20-16-34(2)38(6)24-44)47-27-41(9)55-49-31-52-50(32-51(49)57(11,12)53(55)29-47)56-42(10)28-48(30-54(56)58(52,13)14)60(45-21-17-35(3)39(7)25-45)46-22-18-36(4)40(8)26-46/h15-32H,1-14H3 |
| InChIKey | SJKRKCUAROSGNL-UHFFFAOYSA-N |
| XLogP | 16.32 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 785.13 |
| LogP ≤ 5 | 16.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |