C53H38N6 — CID 161129208
4-(N-[3-(9,9-dimethylacridin-10-yl)-5-(10-phenylphenazin-5-yl)phenyl]-4-isocyanoanilino)benzonitrile (PubChem CID 161129208) has the molecular formula C53H38N6 and a molecular weight of 758.93 g/mol. Its IUPAC name is 4-(N-[3-(9,9-dimethylacridin-10-yl)-5-(10-phenylphenazin-5-yl)phenyl]-4-isocyanoanilino)benzonitrile.
| Compound Name | 4-(N-[3-(9,9-dimethylacridin-10-yl)-5-(10-phenylphenazin-5-yl)phenyl]-4-isocyanoanilino)benzonitrile |
|---|---|
| PubChem CID | 161129208 |
| Molecular Formula | C53H38N6 |
| Molecular Weight | 758.93 g/mol |
| Exact Mass | 758.32 |
| IUPAC Name | 4-(N-[3-(9,9-dimethylacridin-10-yl)-5-(10-phenylphenazin-5-yl)phenyl]-4-isocyanoanilino)benzonitrile |
| SMILES | [C-]#[N+]c1ccc(N(c2ccc(C#N)cc2)c2cc(N3c4ccccc4N(c4ccccc4)c4ccccc43)cc(N3c4ccccc4C(C)(C)c4ccccc43)c2)cc1 |
| InChI | InChI=1S/C53H38N6/c1-53(2)45-17-7-9-19-47(45)58(48-20-10-8-18-46(48)53)43-33-42(56(40-29-25-37(36-54)26-30-40)41-31-27-38(55-3)28-32-41)34-44(35-43)59-51-23-13-11-21-49(51)57(39-15-5-4-6-16-39)50-22-12-14-24-52(50)59/h4-35H,1-2H3 |
| InChIKey | ZAKDRZAYMRHPOJ-UHFFFAOYSA-N |
| XLogP | 14.94 |
| TPSA | 41.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 758.93 |
| LogP ≤ 5 | 14.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|