C63H40N4 — CID 140827092
2-[4-(N-(3,5-diphenylphenyl)anilino)phenyl]-7'-isocyano-10-phenylspiro[acridine-9,9'-fluorene]-2'-carbonitrile (PubChem CID 140827092) has the molecular formula C63H40N4 and a molecular weight of 853.04 g/mol. Its IUPAC name is 2-[4-(N-(3,5-diphenylphenyl)anilino)phenyl]-7'-isocyano-10-phenylspiro[acridine-9,9'-fluorene]-2'-carbonitrile.
| Compound Name | 2-[4-(N-(3,5-diphenylphenyl)anilino)phenyl]-7'-isocyano-10-phenylspiro[acridine-9,9'-fluorene]-2'-carbonitrile |
|---|---|
| PubChem CID | 140827092 |
| Molecular Formula | C63H40N4 |
| Molecular Weight | 853.04 g/mol |
| Exact Mass | 852.33 |
| IUPAC Name | 2-[4-(N-(3,5-diphenylphenyl)anilino)phenyl]-7'-isocyano-10-phenylspiro[acridine-9,9'-fluorene]-2'-carbonitrile |
| SMILES | [C-]#[N+]c1ccc2c(c1)C1(c3cc(C#N)ccc3-2)c2ccccc2N(c2ccccc2)c2ccc(-c3ccc(N(c4ccccc4)c4cc(-c5ccccc5)cc(-c5ccccc5)c4)cc3)cc21 |
| InChI | InChI=1S/C63H40N4/c1-65-50-30-34-56-55-33-26-43(42-64)36-58(55)63(59(56)41-50)57-24-14-15-25-61(57)67(52-22-12-5-13-23-52)62-35-29-47(40-60(62)63)46-27-31-53(32-28-46)66(51-20-10-4-11-21-51)54-38-48(44-16-6-2-7-17-44)37-49(39-54)45-18-8-3-9-19-45/h2-41H |
| InChIKey | APJTZFYBHMBFFK-UHFFFAOYSA-N |
| XLogP | 16.73 |
| TPSA | 34.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 853.04 |
| LogP ≤ 5 | 16.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|