C44H30N4 — CID 58050698
4-(N-[6-(N-(4-isocyanophenyl)anilino)-4,9-dimethylpyren-1-yl]anilino)benzonitrile (PubChem CID 58050698) has the molecular formula C44H30N4 and a molecular weight of 614.75 g/mol. Its IUPAC name is 4-(N-[6-(N-(4-isocyanophenyl)anilino)-4,9-dimethylpyren-1-yl]anilino)benzonitrile.
| Compound Name | 4-(N-[6-(N-(4-isocyanophenyl)anilino)-4,9-dimethylpyren-1-yl]anilino)benzonitrile |
|---|---|
| PubChem CID | 58050698 |
| Molecular Formula | C44H30N4 |
| Molecular Weight | 614.75 g/mol |
| Exact Mass | 614.25 |
| IUPAC Name | 4-(N-[6-(N-(4-isocyanophenyl)anilino)-4,9-dimethylpyren-1-yl]anilino)benzonitrile |
| SMILES | [C-]#[N+]c1ccc(N(c2ccccc2)c2ccc3c(C)cc4c(N(c5ccccc5)c5ccc(C#N)cc5)ccc5c(C)cc2c3c54)cc1 |
| InChI | InChI=1S/C44H30N4/c1-29-26-39-41(47(33-10-6-4-7-11-33)35-18-14-31(28-45)15-19-35)24-22-37-30(2)27-40-42(25-23-38(29)44(40)43(37)39)48(34-12-8-5-9-13-34)36-20-16-32(46-3)17-21-36/h4-27H,1-2H3 |
| InChIKey | QBXSGBOTSTXDQT-UHFFFAOYSA-N |
| XLogP | 12.56 |
| TPSA | 34.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.75 |
| LogP ≤ 5 | 12.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|