C68H38F2N6 — CID 59357839
4-[2-(4-cyanophenyl)-5-(N-[6-(N-[4-(4-cyanophenyl)-2-fluoro-5-(4-isocyanophenyl)phenyl]anilino)pyren-1-yl]anilino)-4-fluorophenyl]benzonitrile (PubChem CID 59357839) has the molecular formula C68H38F2N6 and a molecular weight of 977.09 g/mol. Its IUPAC name is 4-[2-(4-cyanophenyl)-5-(N-[6-(N-[4-(4-cyanophenyl)-2-fluoro-5-(4-isocyanophenyl)phenyl]anilino)pyren-1-yl]anilino)-4-fluorophenyl]benzonitrile.
| Compound Name | 4-[2-(4-cyanophenyl)-5-(N-[6-(N-[4-(4-cyanophenyl)-2-fluoro-5-(4-isocyanophenyl)phenyl]anilino)pyren-1-yl]anilino)-4-fluorophenyl]benzonitrile |
|---|---|
| PubChem CID | 59357839 |
| Molecular Formula | C68H38F2N6 |
| Molecular Weight | 977.09 g/mol |
| Exact Mass | 976.31 |
| IUPAC Name | 4-[2-(4-cyanophenyl)-5-(N-[6-(N-[4-(4-cyanophenyl)-2-fluoro-5-(4-isocyanophenyl)phenyl]anilino)pyren-1-yl]anilino)-4-fluorophenyl]benzonitrile |
| SMILES | [C-]#[N+]c1ccc(-c2cc(N(c3ccccc3)c3ccc4ccc5c(N(c6ccccc6)c6cc(-c7ccc(C#N)cc7)c(-c7ccc(C#N)cc7)cc6F)ccc6ccc3c4c65)c(F)cc2-c2ccc(C#N)cc2)cc1 |
| InChI | InChI=1S/C68H38F2N6/c1-74-52-30-24-49(25-31-52)60-39-66(62(70)37-58(60)47-20-14-44(41-72)15-21-47)76(54-10-6-3-7-11-54)64-35-29-51-26-32-55-63(34-28-50-27-33-56(64)68(51)67(50)55)75(53-8-4-2-5-9-53)65-38-59(48-22-16-45(42-73)17-23-48)57(36-61(65)69)46-18-12-43(40-71)13-19-46/h2-39H |
| InChIKey | ZPNVXYVICKUDAH-UHFFFAOYSA-N |
| XLogP | 18.64 |
| TPSA | 82.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 76 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 977.09 |
| LogP ≤ 5 | 18.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|