C58H38F4N4 — CID 58099514
4-[4-(2,5-dimethylphenyl)-N-[6-(N-[4-(2,5-dimethylphenyl)-2,5-difluorophenyl]-4-isocyanoanilino)pyren-1-yl]-2,5-difluoroanilino]benzonitrile (PubChem CID 58099514) has the molecular formula C58H38F4N4 and a molecular weight of 866.96 g/mol. Its IUPAC name is 4-[4-(2,5-dimethylphenyl)-N-[6-(N-[4-(2,5-dimethylphenyl)-2,5-difluorophenyl]-4-isocyanoanilino)pyren-1-yl]-2,5-difluoroanilino]benzonitrile.
| Compound Name | 4-[4-(2,5-dimethylphenyl)-N-[6-(N-[4-(2,5-dimethylphenyl)-2,5-difluorophenyl]-4-isocyanoanilino)pyren-1-yl]-2,5-difluoroanilino]benzonitrile |
|---|---|
| PubChem CID | 58099514 |
| Molecular Formula | C58H38F4N4 |
| Molecular Weight | 866.96 g/mol |
| Exact Mass | 866.30 |
| IUPAC Name | 4-[4-(2,5-dimethylphenyl)-N-[6-(N-[4-(2,5-dimethylphenyl)-2,5-difluorophenyl]-4-isocyanoanilino)pyren-1-yl]-2,5-difluoroanilino]benzonitrile |
| SMILES | [C-]#[N+]c1ccc(N(c2cc(F)c(-c3cc(C)ccc3C)cc2F)c2ccc3ccc4c(N(c5ccc(C#N)cc5)c5cc(F)c(-c6cc(C)ccc6C)cc5F)ccc5ccc2c3c54)cc1 |
| InChI | InChI=1S/C58H38F4N4/c1-33-6-8-35(3)45(26-33)47-28-51(61)55(30-49(47)59)65(41-18-10-37(32-63)11-19-41)53-24-14-38-13-23-44-54(25-15-39-12-22-43(53)57(38)58(39)44)66(42-20-16-40(64-5)17-21-42)56-31-50(60)48(29-52(56)62)46-27-34(2)7-9-36(46)4/h6-31H,1-4H3 |
| InChIKey | LDFRPYZLUISRJU-UHFFFAOYSA-N |
| XLogP | 17.07 |
| TPSA | 34.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 866.96 |
| LogP ≤ 5 | 17.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|