C50H42N4 — CID 58050664
4-(N-[6-(N-(3,5-dimethylphenyl)-4-isocyanoanilino)-3,8-diethylpyren-1-yl]-3,5-dimethylanilino)benzonitrile (PubChem CID 58050664) has the molecular formula C50H42N4 and a molecular weight of 698.91 g/mol. Its IUPAC name is 4-(N-[6-(N-(3,5-dimethylphenyl)-4-isocyanoanilino)-3,8-diethylpyren-1-yl]-3,5-dimethylanilino)benzonitrile.
| Compound Name | 4-(N-[6-(N-(3,5-dimethylphenyl)-4-isocyanoanilino)-3,8-diethylpyren-1-yl]-3,5-dimethylanilino)benzonitrile |
|---|---|
| PubChem CID | 58050664 |
| Molecular Formula | C50H42N4 |
| Molecular Weight | 698.91 g/mol |
| Exact Mass | 698.34 |
| IUPAC Name | 4-(N-[6-(N-(3,5-dimethylphenyl)-4-isocyanoanilino)-3,8-diethylpyren-1-yl]-3,5-dimethylanilino)benzonitrile |
| SMILES | [C-]#[N+]c1ccc(N(c2cc(C)cc(C)c2)c2cc(CC)c3ccc4c(N(c5ccc(C#N)cc5)c5cc(C)cc(C)c5)cc(CC)c5ccc2c3c54)cc1 |
| InChI | InChI=1S/C50H42N4/c1-8-36-28-47(53(39-14-10-35(30-51)11-15-39)41-24-31(3)22-32(4)25-41)45-20-18-44-37(9-2)29-48(46-21-19-43(36)49(45)50(44)46)54(40-16-12-38(52-7)13-17-40)42-26-33(5)23-34(6)27-42/h10-29H,8-9H2,1-6H3 |
| InChIKey | IFICGDATXRKJIR-UHFFFAOYSA-N |
| XLogP | 14.30 |
| TPSA | 34.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.91 |
| LogP ≤ 5 | 14.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|