C50H42N4 — CID 88561095
4-(N-[6-(N-(4-cyanophenyl)-4-ethylanilino)-3,8-diethylpyren-1-yl]-4-ethylanilino)benzonitrile (PubChem CID 88561095) has the molecular formula C50H42N4 and a molecular weight of 698.91 g/mol. Its IUPAC name is 4-(N-[6-(N-(4-cyanophenyl)-4-ethylanilino)-3,8-diethylpyren-1-yl]-4-ethylanilino)benzonitrile.
| Compound Name | 4-(N-[6-(N-(4-cyanophenyl)-4-ethylanilino)-3,8-diethylpyren-1-yl]-4-ethylanilino)benzonitrile |
|---|---|
| PubChem CID | 88561095 |
| Molecular Formula | C50H42N4 |
| Molecular Weight | 698.91 g/mol |
| Exact Mass | 698.34 |
| IUPAC Name | 4-(N-[6-(N-(4-cyanophenyl)-4-ethylanilino)-3,8-diethylpyren-1-yl]-4-ethylanilino)benzonitrile |
| SMILES | CCc1ccc(N(c2ccc(C#N)cc2)c2cc(CC)c3ccc4c(N(c5ccc(C#N)cc5)c5ccc(CC)cc5)cc(CC)c5ccc2c3c54)cc1 |
| InChI | InChI=1S/C50H42N4/c1-5-33-9-17-39(18-10-33)53(41-21-13-35(31-51)14-22-41)47-29-37(7-3)43-26-28-46-48(30-38(8-4)44-25-27-45(47)49(43)50(44)46)54(40-19-11-34(6-2)12-20-40)42-23-15-36(32-52)16-24-42/h9-30H,5-8H2,1-4H3 |
| InChIKey | UKIPMWHWDQEYNR-UHFFFAOYSA-N |
| XLogP | 13.52 |
| TPSA | 54.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.91 |
| LogP ≤ 5 | 13.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|