About 4-ethylbenzonitrile;fluoromethane
4-ethylbenzonitrile;fluoromethane (PubChem CID 143083977) has the molecular formula C10H12FN
and a molecular weight of 165.21 g/mol. Its IUPAC name is 4-ethylbenzonitrile;fluoromethane.
Molecular Properties
| Compound Name | 4-ethylbenzonitrile;fluoromethane |
| PubChem CID | 143083977 |
| Molecular Formula | C10H12FN |
| Molecular Weight | 165.21 g/mol |
| Exact Mass | 165.10 |
| IUPAC Name | 4-ethylbenzonitrile;fluoromethane |
| SMILES | CCc1ccc(C#N)cc1.CF |
| InChI | InChI=1S/C9H9N.CH3F/c1-2-8-3-5-9(7-10)6-4-8;1-2/h3-6H,2H2,1H3;1H3 |
| InChIKey | KIYNLPRMBGYGPS-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.21 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-ethylbenzonitrile;fluoromethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethylbenzonitrile;fluoromethane?
The IUPAC name of 4-ethylbenzonitrile;fluoromethane (CID 143083977) is 4-ethylbenzonitrile;fluoromethane.
What is the SMILES notation for 4-ethylbenzonitrile;fluoromethane?
The canonical SMILES for 4-ethylbenzonitrile;fluoromethane is CCc1ccc(C#N)cc1.CF.
What is the InChIKey of 4-ethylbenzonitrile;fluoromethane?
The InChIKey is KIYNLPRMBGYGPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N.CH3F/c1-2-8-3-5-9(7-10)6-4-8;1-2/h3-6H,2H2,1H3;1H3.
What are the key properties of 4-ethylbenzonitrile;fluoromethane?
4-ethylbenzonitrile;fluoromethane has a molecular weight of 165.21 g/mol, XLogP of 2.71, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethylbenzonitrile;fluoromethane is sourced from PubChem (CID 143083977), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).