C42H32N4 — CID 153465934
4-(N-[6-(5-isocyano-3,3-dimethyl-2H-indol-1-yl)pyren-1-yl]-3,5-dimethylanilino)benzonitrile (PubChem CID 153465934) has the molecular formula C42H32N4 and a molecular weight of 592.75 g/mol. Its IUPAC name is 4-(N-[6-(5-isocyano-3,3-dimethyl-2H-indol-1-yl)pyren-1-yl]-3,5-dimethylanilino)benzonitrile.
| Compound Name | 4-(N-[6-(5-isocyano-3,3-dimethyl-2H-indol-1-yl)pyren-1-yl]-3,5-dimethylanilino)benzonitrile |
|---|---|
| PubChem CID | 153465934 |
| Molecular Formula | C42H32N4 |
| Molecular Weight | 592.75 g/mol |
| Exact Mass | 592.26 |
| IUPAC Name | 4-(N-[6-(5-isocyano-3,3-dimethyl-2H-indol-1-yl)pyren-1-yl]-3,5-dimethylanilino)benzonitrile |
| SMILES | [C-]#[N+]c1ccc2c(c1)C(C)(C)CN2c1ccc2ccc3c(N(c4ccc(C#N)cc4)c4cc(C)cc(C)c4)ccc4ccc1c2c43 |
| InChI | InChI=1S/C42H32N4/c1-26-20-27(2)22-33(21-26)46(32-13-6-28(24-43)7-14-32)38-18-11-30-8-15-34-37(17-10-29-9-16-35(38)41(30)40(29)34)45-25-42(3,4)36-23-31(44-5)12-19-39(36)45/h6-23H,25H2,1-4H3 |
| InChIKey | VEELCVVJNUFLMR-UHFFFAOYSA-N |
| XLogP | 11.52 |
| TPSA | 34.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.75 |
| LogP ≤ 5 | 11.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|