C56H58N4Si2 — CID 167340535
4-(4-tert-butyl-N-[6-(4-tert-butyl-N-(4-isocyanophenyl)anilino)-3,8-bis(trimethylsilyl)pyren-1-yl]anilino)benzonitrile (PubChem CID 167340535) has the molecular formula C56H58N4Si2 and a molecular weight of 843.28 g/mol. Its IUPAC name is 4-(4-tert-butyl-N-[6-(4-tert-butyl-N-(4-isocyanophenyl)anilino)-3,8-bis(trimethylsilyl)pyren-1-yl]anilino)benzonitrile.
| Compound Name | 4-(4-tert-butyl-N-[6-(4-tert-butyl-N-(4-isocyanophenyl)anilino)-3,8-bis(trimethylsilyl)pyren-1-yl]anilino)benzonitrile |
|---|---|
| PubChem CID | 167340535 |
| Molecular Formula | C56H58N4Si2 |
| Molecular Weight | 843.28 g/mol |
| Exact Mass | 842.42 |
| IUPAC Name | 4-(4-tert-butyl-N-[6-(4-tert-butyl-N-(4-isocyanophenyl)anilino)-3,8-bis(trimethylsilyl)pyren-1-yl]anilino)benzonitrile |
| SMILES | [C-]#[N+]c1ccc(N(c2ccc(C(C)(C)C)cc2)c2cc([Si](C)(C)C)c3ccc4c(N(c5ccc(C#N)cc5)c5ccc(C(C)(C)C)cc5)cc([Si](C)(C)C)c5ccc2c3c45)cc1 |
| InChI | InChI=1S/C56H58N4Si2/c1-55(2,3)38-16-24-42(25-17-38)59(41-22-14-37(36-57)15-23-41)49-34-51(61(8,9)10)47-33-31-46-50(35-52(62(11,12)13)48-32-30-45(49)53(47)54(46)48)60(44-28-20-40(58-7)21-29-44)43-26-18-39(19-27-43)56(4,5)6/h14-35H,1-6,8-13H3 |
| InChIKey | RHORQRPBRAKMIF-UHFFFAOYSA-N |
| XLogP | 15.63 |
| TPSA | 34.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 843.28 |
| LogP ≤ 5 | 15.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|