C40H38N4 — CID 102267120
4-(N-[4-(4-tert-butyl-N-(4-tert-butylphenyl)anilino)phenyl]-4-cyanoanilino)benzonitrile (PubChem CID 102267120) has the molecular formula C40H38N4 and a molecular weight of 574.77 g/mol. Its IUPAC name is 4-(N-[4-(4-tert-butyl-N-(4-tert-butylphenyl)anilino)phenyl]-4-cyanoanilino)benzonitrile.
| Compound Name | 4-(N-[4-(4-tert-butyl-N-(4-tert-butylphenyl)anilino)phenyl]-4-cyanoanilino)benzonitrile |
|---|---|
| PubChem CID | 102267120 |
| Molecular Formula | C40H38N4 |
| Molecular Weight | 574.77 g/mol |
| Exact Mass | 574.31 |
| IUPAC Name | 4-(N-[4-(4-tert-butyl-N-(4-tert-butylphenyl)anilino)phenyl]-4-cyanoanilino)benzonitrile |
| SMILES | CC(C)(C)c1ccc(N(c2ccc(N(c3ccc(C#N)cc3)c3ccc(C#N)cc3)cc2)c2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C40H38N4/c1-39(2,3)31-11-19-35(20-12-31)44(36-21-13-32(14-22-36)40(4,5)6)38-25-23-37(24-26-38)43(33-15-7-29(27-41)8-16-33)34-17-9-30(28-42)10-18-34/h7-26H,1-6H3 |
| InChIKey | ICBLWPRNCQEGAE-UHFFFAOYSA-N |
| XLogP | 10.96 |
| TPSA | 54.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.77 |
| LogP ≤ 5 | 10.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |