C73H67N3 — CID 122374370
3,4,5-tris(4-tert-butylphenyl)-2,6-bis[4-(N-phenylanilino)phenyl]benzonitrile (PubChem CID 122374370) has the molecular formula C73H67N3 and a molecular weight of 986.36 g/mol. Its IUPAC name is 3,4,5-tris(4-tert-butylphenyl)-2,6-bis[4-(N-phenylanilino)phenyl]benzonitrile.
| Compound Name | 3,4,5-tris(4-tert-butylphenyl)-2,6-bis[4-(N-phenylanilino)phenyl]benzonitrile |
|---|---|
| PubChem CID | 122374370 |
| Molecular Formula | C73H67N3 |
| Molecular Weight | 986.36 g/mol |
| Exact Mass | 985.53 |
| IUPAC Name | 3,4,5-tris(4-tert-butylphenyl)-2,6-bis[4-(N-phenylanilino)phenyl]benzonitrile |
| SMILES | CC(C)(C)c1ccc(-c2c(-c3ccc(N(c4ccccc4)c4ccccc4)cc3)c(C#N)c(-c3ccc(N(c4ccccc4)c4ccccc4)cc3)c(-c3ccc(C(C)(C)C)cc3)c2-c2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C73H67N3/c1-71(2,3)56-40-30-53(31-41-56)68-66(51-36-46-63(47-37-51)75(59-22-14-10-15-23-59)60-24-16-11-17-25-60)65(50-74)67(52-38-48-64(49-39-52)76(61-26-18-12-19-27-61)62-28-20-13-21-29-62)69(54-32-42-57(43-33-54)72(4,5)6)70(68)55-34-44-58(45-35-55)73(7,8)9/h10-49H,1-9H3 |
| InChIKey | RJHGDJFOZREURL-UHFFFAOYSA-N |
| XLogP | 20.73 |
| TPSA | 30.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 76 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 986.36 |
| LogP ≤ 5 | 20.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |