C56H38N4 — CID 140728590
2-isocyano-3,6-diphenyl-4,5-bis[4-(N-phenylanilino)phenyl]benzonitrile (PubChem CID 140728590) has the molecular formula C56H38N4 and a molecular weight of 766.95 g/mol. Its IUPAC name is 2-isocyano-3,6-diphenyl-4,5-bis[4-(N-phenylanilino)phenyl]benzonitrile.
| Compound Name | 2-isocyano-3,6-diphenyl-4,5-bis[4-(N-phenylanilino)phenyl]benzonitrile |
|---|---|
| PubChem CID | 140728590 |
| Molecular Formula | C56H38N4 |
| Molecular Weight | 766.95 g/mol |
| Exact Mass | 766.31 |
| IUPAC Name | 2-isocyano-3,6-diphenyl-4,5-bis[4-(N-phenylanilino)phenyl]benzonitrile |
| SMILES | [C-]#[N+]c1c(C#N)c(-c2ccccc2)c(-c2ccc(N(c3ccccc3)c3ccccc3)cc2)c(-c2ccc(N(c3ccccc3)c3ccccc3)cc2)c1-c1ccccc1 |
| InChI | InChI=1S/C56H38N4/c1-58-56-51(40-57)52(41-20-8-2-9-21-41)53(43-32-36-49(37-33-43)59(45-24-12-4-13-25-45)46-26-14-5-15-27-46)54(55(56)42-22-10-3-11-23-42)44-34-38-50(39-35-44)60(47-28-16-6-17-29-47)48-30-18-7-19-31-48/h2-39H |
| InChIKey | JESBODPLEGFLRG-UHFFFAOYSA-N |
| XLogP | 15.72 |
| TPSA | 34.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 766.95 |
| LogP ≤ 5 | 15.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|