C41H36N4 — CID 140745870
4,5-ditert-butyl-2,3-diisocyano-6-(4-phenyl-N-(4-phenylphenyl)anilino)benzonitrile (PubChem CID 140745870) has the molecular formula C41H36N4 and a molecular weight of 584.77 g/mol. Its IUPAC name is 4,5-ditert-butyl-2,3-diisocyano-6-(4-phenyl-N-(4-phenylphenyl)anilino)benzonitrile.
| Compound Name | 4,5-ditert-butyl-2,3-diisocyano-6-(4-phenyl-N-(4-phenylphenyl)anilino)benzonitrile |
|---|---|
| PubChem CID | 140745870 |
| Molecular Formula | C41H36N4 |
| Molecular Weight | 584.77 g/mol |
| Exact Mass | 584.29 |
| IUPAC Name | 4,5-ditert-butyl-2,3-diisocyano-6-(4-phenyl-N-(4-phenylphenyl)anilino)benzonitrile |
| SMILES | [C-]#[N+]c1c(C#N)c(N(c2ccc(-c3ccccc3)cc2)c2ccc(-c3ccccc3)cc2)c(C(C)(C)C)c(C(C)(C)C)c1[N+]#[C-] |
| InChI | InChI=1S/C41H36N4/c1-40(2,3)35-36(41(4,5)6)39(34(27-42)37(43-7)38(35)44-8)45(32-23-19-30(20-24-32)28-15-11-9-12-16-28)33-25-21-31(22-26-33)29-17-13-10-14-18-29/h9-26H,1-6H3 |
| InChIKey | ZPGGEBKLXMUCNH-UHFFFAOYSA-N |
| XLogP | 12.06 |
| TPSA | 35.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.77 |
| LogP ≤ 5 | 12.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|