C61H42F4N4 — CID 122609805
1,1,3,3-tetrafluoro-2,2-dimethyl-4,7-bis(4-phenyl-N-(4-phenylphenyl)anilino)indene-5,6-dicarbonitrile (PubChem CID 122609805) has the molecular formula C61H42F4N4 and a molecular weight of 907.03 g/mol. Its IUPAC name is 1,1,3,3-tetrafluoro-2,2-dimethyl-4,7-bis(4-phenyl-N-(4-phenylphenyl)anilino)indene-5,6-dicarbonitrile.
| Compound Name | 1,1,3,3-tetrafluoro-2,2-dimethyl-4,7-bis(4-phenyl-N-(4-phenylphenyl)anilino)indene-5,6-dicarbonitrile |
|---|---|
| PubChem CID | 122609805 |
| Molecular Formula | C61H42F4N4 |
| Molecular Weight | 907.03 g/mol |
| Exact Mass | 906.33 |
| IUPAC Name | 1,1,3,3-tetrafluoro-2,2-dimethyl-4,7-bis(4-phenyl-N-(4-phenylphenyl)anilino)indene-5,6-dicarbonitrile |
| SMILES | CC1(C)C(F)(F)c2c(N(c3ccc(-c4ccccc4)cc3)c3ccc(-c4ccccc4)cc3)c(C#N)c(C#N)c(N(c3ccc(-c4ccccc4)cc3)c3ccc(-c4ccccc4)cc3)c2C1(F)F |
| InChI | InChI=1S/C61H42F4N4/c1-59(2)60(62,63)55-56(61(59,64)65)58(69(51-35-27-47(28-36-51)43-19-11-5-12-20-43)52-37-29-48(30-38-52)44-21-13-6-14-22-44)54(40-67)53(39-66)57(55)68(49-31-23-45(24-32-49)41-15-7-3-8-16-41)50-33-25-46(26-34-50)42-17-9-4-10-18-42/h3-38H,1-2H3 |
| InChIKey | GOMDIPNOVLRGGP-UHFFFAOYSA-N |
| XLogP | 17.26 |
| TPSA | 54.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 907.03 |
| LogP ≤ 5 | 17.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |