C67H50F4N4 — CID 122609902
6,7-bis(9,9-dimethyl-2,7-diphenylacridin-10-yl)-1,1,3,3-tetrafluoro-2,2-dimethylindene-4,5-dicarbonitrile (PubChem CID 122609902) has the molecular formula C67H50F4N4 and a molecular weight of 987.16 g/mol. Its IUPAC name is 6,7-bis(9,9-dimethyl-2,7-diphenylacridin-10-yl)-1,1,3,3-tetrafluoro-2,2-dimethylindene-4,5-dicarbonitrile.
| Compound Name | 6,7-bis(9,9-dimethyl-2,7-diphenylacridin-10-yl)-1,1,3,3-tetrafluoro-2,2-dimethylindene-4,5-dicarbonitrile |
|---|---|
| PubChem CID | 122609902 |
| Molecular Formula | C67H50F4N4 |
| Molecular Weight | 987.16 g/mol |
| Exact Mass | 986.40 |
| IUPAC Name | 6,7-bis(9,9-dimethyl-2,7-diphenylacridin-10-yl)-1,1,3,3-tetrafluoro-2,2-dimethylindene-4,5-dicarbonitrile |
| SMILES | CC1(C)c2cc(-c3ccccc3)ccc2N(c2c(C#N)c(C#N)c3c(c2N2c4ccc(-c5ccccc5)cc4C(C)(C)c4cc(-c5ccccc5)ccc42)C(F)(F)C(C)(C)C3(F)F)c2ccc(-c3ccccc3)cc21 |
| InChI | InChI=1S/C67H50F4N4/c1-63(2)51-35-45(41-19-11-7-12-20-41)27-31-55(51)74(56-32-28-46(36-52(56)63)42-21-13-8-14-22-42)61-50(40-73)49(39-72)59-60(67(70,71)65(5,6)66(59,68)69)62(61)75-57-33-29-47(43-23-15-9-16-24-43)37-53(57)64(3,4)54-38-48(30-34-58(54)75)44-25-17-10-18-26-44/h7-38H,1-6H3 |
| InChIKey | YCNSDPAZAPTTMM-UHFFFAOYSA-N |
| XLogP | 18.54 |
| TPSA | 54.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 75 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 987.16 |
| LogP ≤ 5 | 18.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |