C62H47FN4O2 — CID 122609789
5,7-bis(3,7-diphenylphenoxazin-10-yl)-6-fluoro-1,1,2,3,3-pentamethylisoindole-4-carbonitrile (PubChem CID 122609789) has the molecular formula C62H47FN4O2 and a molecular weight of 899.08 g/mol. Its IUPAC name is 5,7-bis(3,7-diphenylphenoxazin-10-yl)-6-fluoro-1,1,2,3,3-pentamethylisoindole-4-carbonitrile.
| Compound Name | 5,7-bis(3,7-diphenylphenoxazin-10-yl)-6-fluoro-1,1,2,3,3-pentamethylisoindole-4-carbonitrile |
|---|---|
| PubChem CID | 122609789 |
| Molecular Formula | C62H47FN4O2 |
| Molecular Weight | 899.08 g/mol |
| Exact Mass | 898.37 |
| IUPAC Name | 5,7-bis(3,7-diphenylphenoxazin-10-yl)-6-fluoro-1,1,2,3,3-pentamethylisoindole-4-carbonitrile |
| SMILES | CN1C(C)(C)c2c(C#N)c(N3c4ccc(-c5ccccc5)cc4Oc4cc(-c5ccccc5)ccc43)c(F)c(N3c4ccc(-c5ccccc5)cc4Oc4cc(-c5ccccc5)ccc43)c2C1(C)C |
| InChI | InChI=1S/C62H47FN4O2/c1-61(2)56-47(38-64)59(66-48-30-26-43(39-18-10-6-11-19-39)34-52(48)68-53-35-44(27-31-49(53)66)40-20-12-7-13-21-40)58(63)60(57(56)62(3,4)65(61)5)67-50-32-28-45(41-22-14-8-15-23-41)36-54(50)69-55-37-46(29-33-51(55)67)42-24-16-9-17-25-42/h6-37H,1-5H3 |
| InChIKey | RQJSQYARPZYGPO-UHFFFAOYSA-N |
| XLogP | 16.93 |
| TPSA | 51.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 899.08 |
| LogP ≤ 5 | 16.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |