C57H41N3O4S — CID 140745658
7-(benzenesulfonyl)-5-(2,7-diphenylspiro[acridine-9,9'-xanthene]-10-yl)-6-isocyano-1,1,3,3-tetramethyl-2-benzofuran-4-carbonitrile (PubChem CID 140745658) has the molecular formula C57H41N3O4S and a molecular weight of 864.04 g/mol. Its IUPAC name is 7-(benzenesulfonyl)-5-(2,7-diphenylspiro[acridine-9,9'-xanthene]-10-yl)-6-isocyano-1,1,3,3-tetramethyl-2-benzofuran-4-carbonitrile.
| Compound Name | 7-(benzenesulfonyl)-5-(2,7-diphenylspiro[acridine-9,9'-xanthene]-10-yl)-6-isocyano-1,1,3,3-tetramethyl-2-benzofuran-4-carbonitrile |
|---|---|
| PubChem CID | 140745658 |
| Molecular Formula | C57H41N3O4S |
| Molecular Weight | 864.04 g/mol |
| Exact Mass | 863.28 |
| IUPAC Name | 7-(benzenesulfonyl)-5-(2,7-diphenylspiro[acridine-9,9'-xanthene]-10-yl)-6-isocyano-1,1,3,3-tetramethyl-2-benzofuran-4-carbonitrile |
| SMILES | [C-]#[N+]c1c(N2c3ccc(-c4ccccc4)cc3C3(c4ccccc4Oc4ccccc43)c3cc(-c4ccccc4)ccc32)c(C#N)c2c(c1S(=O)(=O)c1ccccc1)C(C)(C)OC2(C)C |
| InChI | InChI=1S/C57H41N3O4S/c1-55(2)50-41(35-58)53(52(59-5)54(51(50)56(3,4)64-55)65(61,62)40-23-13-8-14-24-40)60-46-31-29-38(36-19-9-6-10-20-36)33-44(46)57(45-34-39(30-32-47(45)60)37-21-11-7-12-22-37)42-25-15-17-27-48(42)63-49-28-18-16-26-43(49)57/h6-34H,1-4H3 |
| InChIKey | SOPNZIGTRJIIJV-UHFFFAOYSA-N |
| XLogP | 14.05 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 864.04 |
| LogP ≤ 5 | 14.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|