C36H22N4O3 — CID 140745694
5-(3,7-diphenylphenoxazin-10-yl)-6,7-diisocyano-2,2-dimethyl-1,3-benzodioxole-4-carbonitrile (PubChem CID 140745694) has the molecular formula C36H22N4O3 and a molecular weight of 558.60 g/mol. Its IUPAC name is 5-(3,7-diphenylphenoxazin-10-yl)-6,7-diisocyano-2,2-dimethyl-1,3-benzodioxole-4-carbonitrile.
| Compound Name | 5-(3,7-diphenylphenoxazin-10-yl)-6,7-diisocyano-2,2-dimethyl-1,3-benzodioxole-4-carbonitrile |
|---|---|
| PubChem CID | 140745694 |
| Molecular Formula | C36H22N4O3 |
| Molecular Weight | 558.60 g/mol |
| Exact Mass | 558.17 |
| IUPAC Name | 5-(3,7-diphenylphenoxazin-10-yl)-6,7-diisocyano-2,2-dimethyl-1,3-benzodioxole-4-carbonitrile |
| SMILES | [C-]#[N+]c1c([N+]#[C-])c(N2c3ccc(-c4ccccc4)cc3Oc3cc(-c4ccccc4)ccc32)c(C#N)c2c1OC(C)(C)O2 |
| InChI | InChI=1S/C36H22N4O3/c1-36(2)42-34-26(21-37)33(31(38-3)32(39-4)35(34)43-36)40-27-17-15-24(22-11-7-5-8-12-22)19-29(27)41-30-20-25(16-18-28(30)40)23-13-9-6-10-14-23/h5-20H,1-2H3 |
| InChIKey | KVRFBZGTFFQWIS-UHFFFAOYSA-N |
| XLogP | 10.08 |
| TPSA | 63.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.60 |
| LogP ≤ 5 | 10.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|