C49H32N3OP — CID 165156151
4-[4-(3,7-diphenylphenoxazin-10-yl)phenyl]-6-isocyano-1,1-diphenyl-1λ5-phosphacyclohexa-1,3,5-triene-2-carbonitrile (PubChem CID 165156151) has the molecular formula C49H32N3OP and a molecular weight of 709.79 g/mol. Its IUPAC name is 4-[4-(3,7-diphenylphenoxazin-10-yl)phenyl]-6-isocyano-1,1-diphenyl-1λ5-phosphacyclohexa-1,3,5-triene-2-carbonitrile.
| Compound Name | 4-[4-(3,7-diphenylphenoxazin-10-yl)phenyl]-6-isocyano-1,1-diphenyl-1λ5-phosphacyclohexa-1,3,5-triene-2-carbonitrile |
|---|---|
| PubChem CID | 165156151 |
| Molecular Formula | C49H32N3OP |
| Molecular Weight | 709.79 g/mol |
| Exact Mass | 709.23 |
| IUPAC Name | 4-[4-(3,7-diphenylphenoxazin-10-yl)phenyl]-6-isocyano-1,1-diphenyl-1λ5-phosphacyclohexa-1,3,5-triene-2-carbonitrile |
| SMILES | [C-]#[N+]C1=CC(c2ccc(N3c4ccc(-c5ccccc5)cc4Oc4cc(-c5ccccc5)ccc43)cc2)=CC(C#N)=P1(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C49H32N3OP/c1-51-49-33-40(30-44(34-50)54(49,42-18-10-4-11-19-42)43-20-12-5-13-21-43)37-22-26-41(27-23-37)52-45-28-24-38(35-14-6-2-7-15-35)31-47(45)53-48-32-39(25-29-46(48)52)36-16-8-3-9-17-36/h2-33H |
| InChIKey | DATLWJLIZQWSQW-UHFFFAOYSA-N |
| XLogP | 12.12 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.79 |
| LogP ≤ 5 | 12.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|