C56H36N7P — CID 164787116
6-isocyano-1,1-bis[4-(10-phenylphenazin-5-yl)phenyl]-1λ5-phosphacyclohexa-2,4,6-triene-2,4-dicarbonitrile (PubChem CID 164787116) has the molecular formula C56H36N7P and a molecular weight of 837.93 g/mol. Its IUPAC name is 6-isocyano-1,1-bis[4-(10-phenylphenazin-5-yl)phenyl]-1λ5-phosphacyclohexa-2,4,6-triene-2,4-dicarbonitrile.
| Compound Name | 6-isocyano-1,1-bis[4-(10-phenylphenazin-5-yl)phenyl]-1λ5-phosphacyclohexa-2,4,6-triene-2,4-dicarbonitrile |
|---|---|
| PubChem CID | 164787116 |
| Molecular Formula | C56H36N7P |
| Molecular Weight | 837.93 g/mol |
| Exact Mass | 837.28 |
| IUPAC Name | 6-isocyano-1,1-bis[4-(10-phenylphenazin-5-yl)phenyl]-1λ5-phosphacyclohexa-2,4,6-triene-2,4-dicarbonitrile |
| SMILES | [C-]#[N+]C1=P(c2ccc(N3c4ccccc4N(c4ccccc4)c4ccccc43)cc2)(c2ccc(N3c4ccccc4N(c4ccccc4)c4ccccc43)cc2)C(C#N)=CC(C#N)=C1 |
| InChI | InChI=1S/C56H36N7P/c1-59-56-37-40(38-57)36-47(39-58)64(56,45-32-28-43(29-33-45)62-52-24-12-8-20-48(52)60(41-16-4-2-5-17-41)49-21-9-13-25-53(49)62)46-34-30-44(31-35-46)63-54-26-14-10-22-50(54)61(42-18-6-3-7-19-42)51-23-11-15-27-55(51)63/h2-37H |
| InChIKey | GTDCJWFQLVBFCK-UHFFFAOYSA-N |
| XLogP | 14.08 |
| TPSA | 64.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 837.93 |
| LogP ≤ 5 | 14.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|