C20H12F3N2P — CID 164787094
6-isocyano-1,1-diphenyl-4-(trifluoromethyl)-1λ5-phosphacyclohexa-2,4,6-triene-2-carbonitrile (PubChem CID 164787094) has the molecular formula C20H12F3N2P and a molecular weight of 368.30 g/mol. Its IUPAC name is 6-isocyano-1,1-diphenyl-4-(trifluoromethyl)-1λ5-phosphacyclohexa-2,4,6-triene-2-carbonitrile.
| Compound Name | 6-isocyano-1,1-diphenyl-4-(trifluoromethyl)-1λ5-phosphacyclohexa-2,4,6-triene-2-carbonitrile |
|---|---|
| PubChem CID | 164787094 |
| Molecular Formula | C20H12F3N2P |
| Molecular Weight | 368.30 g/mol |
| Exact Mass | 368.07 |
| IUPAC Name | 6-isocyano-1,1-diphenyl-4-(trifluoromethyl)-1λ5-phosphacyclohexa-2,4,6-triene-2-carbonitrile |
| SMILES | [C-]#[N+]C1=P(c2ccccc2)(c2ccccc2)C(C#N)=CC(C(F)(F)F)=C1 |
| InChI | InChI=1S/C20H12F3N2P/c1-25-19-13-15(20(21,22)23)12-18(14-24)26(19,16-8-4-2-5-9-16)17-10-6-3-7-11-17/h2-13H |
| InChIKey | DPJHZQWRMXEJDN-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 28.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.30 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|