C37H24N3P — CID 165156153
6-isocyano-1,1-diphenyl-4-(9-phenylcarbazol-3-yl)-1λ5-phosphacyclohexa-1,3,5-triene-2-carbonitrile (PubChem CID 165156153) has the molecular formula C37H24N3P and a molecular weight of 541.59 g/mol. Its IUPAC name is 6-isocyano-1,1-diphenyl-4-(9-phenylcarbazol-3-yl)-1λ5-phosphacyclohexa-1,3,5-triene-2-carbonitrile.
| Compound Name | 6-isocyano-1,1-diphenyl-4-(9-phenylcarbazol-3-yl)-1λ5-phosphacyclohexa-1,3,5-triene-2-carbonitrile |
|---|---|
| PubChem CID | 165156153 |
| Molecular Formula | C37H24N3P |
| Molecular Weight | 541.59 g/mol |
| Exact Mass | 541.17 |
| IUPAC Name | 6-isocyano-1,1-diphenyl-4-(9-phenylcarbazol-3-yl)-1λ5-phosphacyclohexa-1,3,5-triene-2-carbonitrile |
| SMILES | [C-]#[N+]C1=CC(c2ccc3c(c2)c2ccccc2n3-c2ccccc2)=CC(C#N)=P1(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C37H24N3P/c1-39-37-25-28(23-32(26-38)41(37,30-15-7-3-8-16-30)31-17-9-4-10-18-31)27-21-22-36-34(24-27)33-19-11-12-20-35(33)40(36)29-13-5-2-6-14-29/h2-25H |
| InChIKey | ANUHEWUSNPCRPV-UHFFFAOYSA-N |
| XLogP | 8.31 |
| TPSA | 33.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.59 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|