C31H20N3PS — CID 167100773
4-phenothiazin-10-yl-1,1-diphenyl-1λ5-phosphacyclohexa-1,3,5-triene-2,6-dicarbonitrile (PubChem CID 167100773) has the molecular formula C31H20N3PS and a molecular weight of 497.56 g/mol. Its IUPAC name is 4-phenothiazin-10-yl-1,1-diphenyl-1λ5-phosphacyclohexa-1,3,5-triene-2,6-dicarbonitrile.
| Compound Name | 4-phenothiazin-10-yl-1,1-diphenyl-1λ5-phosphacyclohexa-1,3,5-triene-2,6-dicarbonitrile |
|---|---|
| PubChem CID | 167100773 |
| Molecular Formula | C31H20N3PS |
| Molecular Weight | 497.56 g/mol |
| Exact Mass | 497.11 |
| IUPAC Name | 4-phenothiazin-10-yl-1,1-diphenyl-1λ5-phosphacyclohexa-1,3,5-triene-2,6-dicarbonitrile |
| SMILES | N#CC1=CC(N2c3ccccc3Sc3ccccc32)=CC(C#N)=P1(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H20N3PS/c32-21-26-19-23(34-28-15-7-9-17-30(28)36-31-18-10-8-16-29(31)34)20-27(22-33)35(26,24-11-3-1-4-12-24)25-13-5-2-6-14-25/h1-20H |
| InChIKey | HGBAGDIIGTXLJT-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 50.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.56 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|