C17H8F2N4S — CID 146669264
4,6-difluoro-2-phenothiazin-10-ylpyrimidine-5-carbonitrile (PubChem CID 146669264) has the molecular formula C17H8F2N4S and a molecular weight of 338.34 g/mol. Its IUPAC name is 4,6-difluoro-2-phenothiazin-10-ylpyrimidine-5-carbonitrile.
| Compound Name | 4,6-difluoro-2-phenothiazin-10-ylpyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 146669264 |
| Molecular Formula | C17H8F2N4S |
| Molecular Weight | 338.34 g/mol |
| Exact Mass | 338.04 |
| IUPAC Name | 4,6-difluoro-2-phenothiazin-10-ylpyrimidine-5-carbonitrile |
| SMILES | N#Cc1c(F)nc(N2c3ccccc3Sc3ccccc32)nc1F |
| InChI | InChI=1S/C17H8F2N4S/c18-15-10(9-20)16(19)22-17(21-15)23-11-5-1-3-7-13(11)24-14-8-4-2-6-12(14)23/h1-8H |
| InChIKey | LRHFBJGGNPLOFL-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 52.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.34 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |