C36H25IN4S2 — CID 170275415
2-butyl-5-iodo-4,6-di(phenothiazin-10-yl)benzene-1,3-dicarbonitrile (PubChem CID 170275415) has the molecular formula C36H25IN4S2 and a molecular weight of 704.66 g/mol. Its IUPAC name is 2-butyl-5-iodo-4,6-di(phenothiazin-10-yl)benzene-1,3-dicarbonitrile.
| Compound Name | 2-butyl-5-iodo-4,6-di(phenothiazin-10-yl)benzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 170275415 |
| Molecular Formula | C36H25IN4S2 |
| Molecular Weight | 704.66 g/mol |
| Exact Mass | 704.06 |
| IUPAC Name | 2-butyl-5-iodo-4,6-di(phenothiazin-10-yl)benzene-1,3-dicarbonitrile |
| SMILES | CCCCc1c(C#N)c(N2c3ccccc3Sc3ccccc32)c(I)c(N2c3ccccc3Sc3ccccc32)c1C#N |
| InChI | InChI=1S/C36H25IN4S2/c1-2-3-12-23-24(21-38)35(40-26-13-4-8-17-30(26)42-31-18-9-5-14-27(31)40)34(37)36(25(23)22-39)41-28-15-6-10-19-32(28)43-33-20-11-7-16-29(33)41/h4-11,13-20H,2-3,12H2,1H3 |
| InChIKey | WTNCBQQNRXZUMI-UHFFFAOYSA-N |
| XLogP | 11.25 |
| TPSA | 54.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.66 |
| LogP ≤ 5 | 11.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|