C29H37N3O2S — CID 139680609
1-heptoxy-4-(3-methylbutoxy)-10-propylphenothiazine-2,3-dicarbonitrile (PubChem CID 139680609) has the molecular formula C29H37N3O2S and a molecular weight of 491.70 g/mol. Its IUPAC name is 1-heptoxy-4-(3-methylbutoxy)-10-propylphenothiazine-2,3-dicarbonitrile.
| Compound Name | 1-heptoxy-4-(3-methylbutoxy)-10-propylphenothiazine-2,3-dicarbonitrile |
|---|---|
| PubChem CID | 139680609 |
| Molecular Formula | C29H37N3O2S |
| Molecular Weight | 491.70 g/mol |
| Exact Mass | 491.26 |
| IUPAC Name | 1-heptoxy-4-(3-methylbutoxy)-10-propylphenothiazine-2,3-dicarbonitrile |
| SMILES | CCCCCCCOc1c(C#N)c(C#N)c(OCCC(C)C)c2c1N(CCC)c1ccccc1S2 |
| InChI | InChI=1S/C29H37N3O2S/c1-5-7-8-9-12-17-33-27-22(19-30)23(20-31)28(34-18-15-21(3)4)29-26(27)32(16-6-2)24-13-10-11-14-25(24)35-29/h10-11,13-14,21H,5-9,12,15-18H2,1-4H3 |
| InChIKey | WHNFGRIOQJFKGE-UHFFFAOYSA-N |
| XLogP | 8.22 |
| TPSA | 69.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.70 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|