C30H41N5O2S — CID 139680523
1,4-bis[3-(diethylamino)butoxy]-10H-phenothiazine-2,3-dicarbonitrile (PubChem CID 139680523) has the molecular formula C30H41N5O2S and a molecular weight of 535.76 g/mol. Its IUPAC name is 1,4-bis[3-(diethylamino)butoxy]-10H-phenothiazine-2,3-dicarbonitrile.
| Compound Name | 1,4-bis[3-(diethylamino)butoxy]-10H-phenothiazine-2,3-dicarbonitrile |
|---|---|
| PubChem CID | 139680523 |
| Molecular Formula | C30H41N5O2S |
| Molecular Weight | 535.76 g/mol |
| Exact Mass | 535.30 |
| IUPAC Name | 1,4-bis[3-(diethylamino)butoxy]-10H-phenothiazine-2,3-dicarbonitrile |
| SMILES | CCN(CC)C(C)CCOc1c(C#N)c(C#N)c(OCCC(C)N(CC)CC)c2c1Nc1ccccc1S2 |
| InChI | InChI=1S/C30H41N5O2S/c1-7-34(8-2)21(5)15-17-36-28-23(19-31)24(20-32)29(37-18-16-22(6)35(9-3)10-4)30-27(28)33-25-13-11-12-14-26(25)38-30/h11-14,21-22,33H,7-10,15-18H2,1-6H3 |
| InChIKey | YETWPJOVGABTCQ-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 84.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.76 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |