About 1-propan-2-yl-10H-phenothiazine;hydrate;tetrahydroiodide
1-propan-2-yl-10H-phenothiazine;hydrate;tetrahydroiodide (PubChem CID 173481491) has the molecular formula C15H21I4NOS
and a molecular weight of 771.02 g/mol. Its IUPAC name is 1-propan-2-yl-10H-phenothiazine;hydrate;tetrahydroiodide.
Molecular Properties
| Compound Name | 1-propan-2-yl-10H-phenothiazine;hydrate;tetrahydroiodide |
| PubChem CID | 173481491 |
| Molecular Formula | C15H21I4NOS |
| Molecular Weight | 771.02 g/mol |
| Exact Mass | 770.75 |
| IUPAC Name | 1-propan-2-yl-10H-phenothiazine;hydrate;tetrahydroiodide |
| SMILES | CC(C)c1cccc2c1Nc1ccccc1S2.I.I.I.I.O |
| InChI | InChI=1S/C15H15NS.4HI.H2O/c1-10(2)11-6-5-9-14-15(11)16-12-7-3-4-8-13(12)17-14;;;;;/h3-10,16H,1-2H3;4*1H;1H2 |
| InChIKey | BGCNGSCWFKREPE-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 43.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 771.02 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-propan-2-yl-10H-phenothiazine;hydrate;tetrahydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-propan-2-yl-10H-phenothiazine;hydrate;tetrahydroiodide?
The IUPAC name of 1-propan-2-yl-10H-phenothiazine;hydrate;tetrahydroiodide (CID 173481491) is 1-propan-2-yl-10H-phenothiazine;hydrate;tetrahydroiodide.
What is the SMILES notation for 1-propan-2-yl-10H-phenothiazine;hydrate;tetrahydroiodide?
The canonical SMILES for 1-propan-2-yl-10H-phenothiazine;hydrate;tetrahydroiodide is CC(C)c1cccc2c1Nc1ccccc1S2.I.I.I.I.O.
What is the InChIKey of 1-propan-2-yl-10H-phenothiazine;hydrate;tetrahydroiodide?
The InChIKey is BGCNGSCWFKREPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15NS.4HI.H2O/c1-10(2)11-6-5-9-14-15(11)16-12-7-3-4-8-13(12)17-14;;;;;/h3-10,16H,1-2H3;4*1H;1H2.
What are the key properties of 1-propan-2-yl-10H-phenothiazine;hydrate;tetrahydroiodide?
1-propan-2-yl-10H-phenothiazine;hydrate;tetrahydroiodide has a molecular weight of 771.02 g/mol, XLogP of 6.67, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-propan-2-yl-10H-phenothiazine;hydrate;tetrahydroiodide is sourced from PubChem (CID 173481491), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).