About boric acid;10H-phenothiazine
boric acid;10H-phenothiazine (PubChem CID 159987394) has the molecular formula C12H12BNO3S
and a molecular weight of 261.11 g/mol. Its IUPAC name is boric acid;10H-phenothiazine.
Molecular Properties
| Compound Name | boric acid;10H-phenothiazine |
| PubChem CID | 159987394 |
| Molecular Formula | C12H12BNO3S |
| Molecular Weight | 261.11 g/mol |
| Exact Mass | 261.06 |
| IUPAC Name | boric acid;10H-phenothiazine |
| SMILES | OB(O)O.c1ccc2c(c1)Nc1ccccc1S2 |
| InChI | InChI=1S/C12H9NS.BH3O3/c1-3-7-11-9(5-1)13-10-6-2-4-8-12(10)14-11;2-1(3)4/h1-8,13H;2-4H |
| InChIKey | OGMXDFHAEFAAAC-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.11 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het_thio_666_A(13)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze boric acid;10H-phenothiazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of boric acid;10H-phenothiazine?
The IUPAC name of boric acid;10H-phenothiazine (CID 159987394) is boric acid;10H-phenothiazine.
What is the SMILES notation for boric acid;10H-phenothiazine?
The canonical SMILES for boric acid;10H-phenothiazine is OB(O)O.c1ccc2c(c1)Nc1ccccc1S2.
What is the InChIKey of boric acid;10H-phenothiazine?
The InChIKey is OGMXDFHAEFAAAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9NS.BH3O3/c1-3-7-11-9(5-1)13-10-6-2-4-8-12(10)14-11;2-1(3)4/h1-8,13H;2-4H.
What are the key properties of boric acid;10H-phenothiazine?
boric acid;10H-phenothiazine has a molecular weight of 261.11 g/mol, XLogP of 1.84, 0 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for boric acid;10H-phenothiazine is sourced from PubChem (CID 159987394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).