About 4-tert-butylphenol;10H-phenothiazine
4-tert-butylphenol;10H-phenothiazine (PubChem CID 175126036) has the molecular formula C22H23NOS
and a molecular weight of 349.50 g/mol. Its IUPAC name is 4-tert-butylphenol;10H-phenothiazine.
Molecular Properties
| Compound Name | 4-tert-butylphenol;10H-phenothiazine |
| PubChem CID | 175126036 |
| Molecular Formula | C22H23NOS |
| Molecular Weight | 349.50 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | 4-tert-butylphenol;10H-phenothiazine |
| SMILES | CC(C)(C)c1ccc(O)cc1.c1ccc2c(c1)Nc1ccccc1S2 |
| InChI | InChI=1S/C12H9NS.C10H14O/c1-3-7-11-9(5-1)13-10-6-2-4-8-12(10)14-11;1-10(2,3)8-4-6-9(11)7-5-8/h1-8,13H;4-7,11H,1-3H3 |
| InChIKey | FDZNCEMBVFCHLU-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 349.50 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het_thio_666_A(13)', 'substructure': 'N/A'} |
|---|
Analyze 4-tert-butylphenol;10H-phenothiazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-tert-butylphenol;10H-phenothiazine?
The IUPAC name of 4-tert-butylphenol;10H-phenothiazine (CID 175126036) is 4-tert-butylphenol;10H-phenothiazine.
What is the SMILES notation for 4-tert-butylphenol;10H-phenothiazine?
The canonical SMILES for 4-tert-butylphenol;10H-phenothiazine is CC(C)(C)c1ccc(O)cc1.c1ccc2c(c1)Nc1ccccc1S2.
What is the InChIKey of 4-tert-butylphenol;10H-phenothiazine?
The InChIKey is FDZNCEMBVFCHLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9NS.C10H14O/c1-3-7-11-9(5-1)13-10-6-2-4-8-12(10)14-11;1-10(2,3)8-4-6-9(11)7-5-8/h1-8,13H;4-7,11H,1-3H3.
What are the key properties of 4-tert-butylphenol;10H-phenothiazine?
4-tert-butylphenol;10H-phenothiazine has a molecular weight of 349.50 g/mol, XLogP of 6.58, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-tert-butylphenol;10H-phenothiazine is sourced from PubChem (CID 175126036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).