About ethylcarbamic acid;10H-phenothiazine
ethylcarbamic acid;10H-phenothiazine (PubChem CID 57349508) has the molecular formula C15H16N2O2S
and a molecular weight of 288.37 g/mol. Its IUPAC name is ethylcarbamic acid;10H-phenothiazine.
Molecular Properties
| Compound Name | ethylcarbamic acid;10H-phenothiazine |
| PubChem CID | 57349508 |
| Molecular Formula | C15H16N2O2S |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | ethylcarbamic acid;10H-phenothiazine |
| SMILES | CCNC(=O)O.c1ccc2c(c1)Nc1ccccc1S2 |
| InChI | InChI=1S/C12H9NS.C3H7NO2/c1-3-7-11-9(5-1)13-10-6-2-4-8-12(10)14-11;1-2-4-3(5)6/h1-8,13H;4H,2H2,1H3,(H,5,6) |
| InChIKey | XQNHLSAKEGCZQZ-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het_thio_666_A(13)', 'substructure': 'N/A'} |
|---|
Analyze ethylcarbamic acid;10H-phenothiazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethylcarbamic acid;10H-phenothiazine?
The IUPAC name of ethylcarbamic acid;10H-phenothiazine (CID 57349508) is ethylcarbamic acid;10H-phenothiazine.
What is the SMILES notation for ethylcarbamic acid;10H-phenothiazine?
The canonical SMILES for ethylcarbamic acid;10H-phenothiazine is CCNC(=O)O.c1ccc2c(c1)Nc1ccccc1S2.
What is the InChIKey of ethylcarbamic acid;10H-phenothiazine?
The InChIKey is XQNHLSAKEGCZQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9NS.C3H7NO2/c1-3-7-11-9(5-1)13-10-6-2-4-8-12(10)14-11;1-2-4-3(5)6/h1-8,13H;4H,2H2,1H3,(H,5,6).
What are the key properties of ethylcarbamic acid;10H-phenothiazine?
ethylcarbamic acid;10H-phenothiazine has a molecular weight of 288.37 g/mol, XLogP of 4.17, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethylcarbamic acid;10H-phenothiazine is sourced from PubChem (CID 57349508), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).