About diphenylmethanone;10H-phenothiazine
diphenylmethanone;10H-phenothiazine (PubChem CID 175143888) has the molecular formula C25H19NOS
and a molecular weight of 381.50 g/mol. Its IUPAC name is diphenylmethanone;10H-phenothiazine.
Molecular Properties
| Compound Name | diphenylmethanone;10H-phenothiazine |
| PubChem CID | 175143888 |
| Molecular Formula | C25H19NOS |
| Molecular Weight | 381.50 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | diphenylmethanone;10H-phenothiazine |
| SMILES | O=C(c1ccccc1)c1ccccc1.c1ccc2c(c1)Nc1ccccc1S2 |
| InChI | InChI=1S/C13H10O.C12H9NS/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12;1-3-7-11-9(5-1)13-10-6-2-4-8-12(10)14-11/h1-10H;1-8,13H |
| InChIKey | YIIZMYFGSARHCM-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 381.50 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het_thio_666_A(13)', 'substructure': 'N/A'} |
|---|
Analyze diphenylmethanone;10H-phenothiazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diphenylmethanone;10H-phenothiazine?
The IUPAC name of diphenylmethanone;10H-phenothiazine (CID 175143888) is diphenylmethanone;10H-phenothiazine.
What is the SMILES notation for diphenylmethanone;10H-phenothiazine?
The canonical SMILES for diphenylmethanone;10H-phenothiazine is O=C(c1ccccc1)c1ccccc1.c1ccc2c(c1)Nc1ccccc1S2.
What is the InChIKey of diphenylmethanone;10H-phenothiazine?
The InChIKey is YIIZMYFGSARHCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10O.C12H9NS/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12;1-3-7-11-9(5-1)13-10-6-2-4-8-12(10)14-11/h1-10H;1-8,13H.
What are the key properties of diphenylmethanone;10H-phenothiazine?
diphenylmethanone;10H-phenothiazine has a molecular weight of 381.50 g/mol, XLogP of 6.81, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for diphenylmethanone;10H-phenothiazine is sourced from PubChem (CID 175143888), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).