C10H9NO2S — CID 4738066
3-methyl-4H-1,4-benzothiazine-2-carboxylic acid (PubChem CID 4738066) has the molecular formula C10H9NO2S and a molecular weight of 207.25 g/mol. Its IUPAC name is 3-methyl-4H-1,4-benzothiazine-2-carboxylic acid.
| Compound Name | 3-methyl-4H-1,4-benzothiazine-2-carboxylic acid |
|---|---|
| PubChem CID | 4738066 |
| Molecular Formula | C10H9NO2S |
| Molecular Weight | 207.25 g/mol |
| Exact Mass | 207.04 |
| IUPAC Name | 3-methyl-4H-1,4-benzothiazine-2-carboxylic acid |
| SMILES | CC1=C(C(=O)O)Sc2ccccc2N1 |
| InChI | InChI=1S/C10H9NO2S/c1-6-9(10(12)13)14-8-5-3-2-4-7(8)11-6/h2-5,11H,1H3,(H,12,13) |
| InChIKey | QBOAXNTVRRLPPN-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.25 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het_thio_66_one(8)', 'substructure': 'N/A'} |
|---|