C13H17NO3S — CID 20980123
methoxyethane;3-methyl-4H-1,4-benzothiazine-2-carboxylic acid (PubChem CID 20980123) has the molecular formula C13H17NO3S and a molecular weight of 267.35 g/mol. Its IUPAC name is methoxyethane;3-methyl-4H-1,4-benzothiazine-2-carboxylic acid.
| Compound Name | methoxyethane;3-methyl-4H-1,4-benzothiazine-2-carboxylic acid |
|---|---|
| PubChem CID | 20980123 |
| Molecular Formula | C13H17NO3S |
| Molecular Weight | 267.35 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | methoxyethane;3-methyl-4H-1,4-benzothiazine-2-carboxylic acid |
| SMILES | CC1=C(C(=O)O)Sc2ccccc2N1.CCOC |
| InChI | InChI=1S/C10H9NO2S.C3H8O/c1-6-9(10(12)13)14-8-5-3-2-4-7(8)11-6;1-3-4-2/h2-5,11H,1H3,(H,12,13);3H2,1-2H3 |
| InChIKey | POGVTCHURWQNSQ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.35 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het_thio_66_one(8)', 'substructure': 'N/A'} |
|---|