C12H13NO4S — CID 69004783
ethyl 2-hydroxy-2-(3-oxo-4H-1,4-benzothiazin-2-yl)acetate (PubChem CID 69004783) has the molecular formula C12H13NO4S and a molecular weight of 267.31 g/mol. Its IUPAC name is ethyl 2-hydroxy-2-(3-oxo-4H-1,4-benzothiazin-2-yl)acetate.
| Compound Name | ethyl 2-hydroxy-2-(3-oxo-4H-1,4-benzothiazin-2-yl)acetate |
|---|---|
| PubChem CID | 69004783 |
| Molecular Formula | C12H13NO4S |
| Molecular Weight | 267.31 g/mol |
| Exact Mass | 267.06 |
| IUPAC Name | ethyl 2-hydroxy-2-(3-oxo-4H-1,4-benzothiazin-2-yl)acetate |
| SMILES | CCOC(=O)C(O)C1Sc2ccccc2NC1=O |
| InChI | InChI=1S/C12H13NO4S/c1-2-17-12(16)9(14)10-11(15)13-7-5-3-4-6-8(7)18-10/h3-6,9-10,14H,2H2,1H3,(H,13,15) |
| InChIKey | BNBUJUQOVSLDJF-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.31 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |