C11H11NO3S — CID 676908
[(2S)-3-oxo-4H-1,4-benzothiazin-2-yl]methyl acetate (PubChem CID 676908) has the molecular formula C11H11NO3S and a molecular weight of 237.28 g/mol. Its IUPAC name is [(2S)-3-oxo-4H-1,4-benzothiazin-2-yl]methyl acetate.
| Compound Name | [(2S)-3-oxo-4H-1,4-benzothiazin-2-yl]methyl acetate |
|---|---|
| PubChem CID | 676908 |
| Molecular Formula | C11H11NO3S |
| Molecular Weight | 237.28 g/mol |
| Exact Mass | 237.05 |
| IUPAC Name | [(2S)-3-oxo-4H-1,4-benzothiazin-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@@H]1Sc2ccccc2NC1=O |
| InChI | InChI=1S/C11H11NO3S/c1-7(13)15-6-10-11(14)12-8-4-2-3-5-9(8)16-10/h2-5,10H,6H2,1H3,(H,12,14)/t10-/m0/s1 |
| InChIKey | IADDOIGRONETAH-JTQLQIEISA-N |
| XLogP | 1.66 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.28 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |