C17H15NO2S — CID 5023549
2-[2-(4-methylphenyl)-2-oxoethyl]-4H-1,4-benzothiazin-3-one (PubChem CID 5023549) has the molecular formula C17H15NO2S and a molecular weight of 297.38 g/mol. Its IUPAC name is 2-[2-(4-methylphenyl)-2-oxoethyl]-4H-1,4-benzothiazin-3-one.
| Compound Name | 2-[2-(4-methylphenyl)-2-oxoethyl]-4H-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 5023549 |
| Molecular Formula | C17H15NO2S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | 2-[2-(4-methylphenyl)-2-oxoethyl]-4H-1,4-benzothiazin-3-one |
| SMILES | Cc1ccc(C(=O)CC2Sc3ccccc3NC2=O)cc1 |
| InChI | InChI=1S/C17H15NO2S/c1-11-6-8-12(9-7-11)14(19)10-16-17(20)18-13-4-2-3-5-15(13)21-16/h2-9,16H,10H2,1H3,(H,18,20) |
| InChIKey | ZCUFRHHKBHLUHV-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |