C16H12FNO2S — CID 134915498
2-[2-(4-fluorophenyl)-2-oxoethyl]-4H-1,4-benzothiazin-3-one (PubChem CID 134915498) has the molecular formula C16H12FNO2S and a molecular weight of 301.34 g/mol. Its IUPAC name is 2-[2-(4-fluorophenyl)-2-oxoethyl]-4H-1,4-benzothiazin-3-one.
| Compound Name | 2-[2-(4-fluorophenyl)-2-oxoethyl]-4H-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 134915498 |
| Molecular Formula | C16H12FNO2S |
| Molecular Weight | 301.34 g/mol |
| Exact Mass | 301.06 |
| IUPAC Name | 2-[2-(4-fluorophenyl)-2-oxoethyl]-4H-1,4-benzothiazin-3-one |
| SMILES | O=C(CC1Sc2ccccc2NC1=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C16H12FNO2S/c17-11-7-5-10(6-8-11)13(19)9-15-16(20)18-12-3-1-2-4-14(12)21-15/h1-8,15H,9H2,(H,18,20) |
| InChIKey | ISMCBLBGUBAOGZ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.34 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |