C21H15FN2O2S — CID 135706945
5-[2-(4-fluorophenyl)-2-oxoethyl]-2-naphthalen-1-ylimino-1,3-thiazolidin-4-one (PubChem CID 135706945) has the molecular formula C21H15FN2O2S and a molecular weight of 378.43 g/mol. Its IUPAC name is 5-[2-(4-fluorophenyl)-2-oxoethyl]-2-naphthalen-1-ylimino-1,3-thiazolidin-4-one.
| Compound Name | 5-[2-(4-fluorophenyl)-2-oxoethyl]-2-naphthalen-1-ylimino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135706945 |
| Molecular Formula | C21H15FN2O2S |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.08 |
| IUPAC Name | 5-[2-(4-fluorophenyl)-2-oxoethyl]-2-naphthalen-1-ylimino-1,3-thiazolidin-4-one |
| SMILES | O=C(CC1S/C(=N\c2cccc3ccccc23)NC1=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C21H15FN2O2S/c22-15-10-8-14(9-11-15)18(25)12-19-20(26)24-21(27-19)23-17-7-3-5-13-4-1-2-6-16(13)17/h1-11,19H,12H2,(H,23,24,26) |
| InChIKey | RDQOIWBHQMKWDM-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|