C22H16FN3O3S — CID 135711877
(2E)-2-[(E)-[5-(4-fluorophenyl)furan-2-yl]methylidenehydrazinylidene]-5-phenacyl-1,3-thiazolidin-4-one (PubChem CID 135711877) has the molecular formula C22H16FN3O3S and a molecular weight of 421.45 g/mol. Its IUPAC name is (2E)-2-[(E)-[5-(4-fluorophenyl)furan-2-yl]methylidenehydrazinylidene]-5-phenacyl-1,3-thiazolidin-4-one.
| Compound Name | (2E)-2-[(E)-[5-(4-fluorophenyl)furan-2-yl]methylidenehydrazinylidene]-5-phenacyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135711877 |
| Molecular Formula | C22H16FN3O3S |
| Molecular Weight | 421.45 g/mol |
| Exact Mass | 421.09 |
| IUPAC Name | (2E)-2-[(E)-[5-(4-fluorophenyl)furan-2-yl]methylidenehydrazinylidene]-5-phenacyl-1,3-thiazolidin-4-one |
| SMILES | O=C(CC1S/C(=N/N=C/c2ccc(-c3ccc(F)cc3)o2)NC1=O)c1ccccc1 |
| InChI | InChI=1S/C22H16FN3O3S/c23-16-8-6-15(7-9-16)19-11-10-17(29-19)13-24-26-22-25-21(28)20(30-22)12-18(27)14-4-2-1-3-5-14/h1-11,13,20H,12H2,(H,25,26,28)/b24-13+ |
| InChIKey | AFXSFSNRTOEPHG-ZMOGYAJESA-N |
| XLogP | 4.28 |
| TPSA | 84.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.45 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|