C19H17N3O6S — CID 135852151
2-[(2Z,5S)-2-[(Z)-[5-(4-ethoxycarbonylphenyl)furan-2-yl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid (PubChem CID 135852151) has the molecular formula C19H17N3O6S and a molecular weight of 415.43 g/mol. Its IUPAC name is 2-[(2Z,5S)-2-[(Z)-[5-(4-ethoxycarbonylphenyl)furan-2-yl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid.
| Compound Name | 2-[(2Z,5S)-2-[(Z)-[5-(4-ethoxycarbonylphenyl)furan-2-yl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid |
|---|---|
| PubChem CID | 135852151 |
| Molecular Formula | C19H17N3O6S |
| Molecular Weight | 415.43 g/mol |
| Exact Mass | 415.08 |
| IUPAC Name | 2-[(2Z,5S)-2-[(Z)-[5-(4-ethoxycarbonylphenyl)furan-2-yl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid |
| SMILES | CCOC(=O)c1ccc(-c2ccc(/C=N\N=C3\NC(=O)[C@H](CC(=O)O)S3)o2)cc1 |
| InChI | InChI=1S/C19H17N3O6S/c1-2-27-18(26)12-5-3-11(4-6-12)14-8-7-13(28-14)10-20-22-19-21-17(25)15(29-19)9-16(23)24/h3-8,10,15H,2,9H2,1H3,(H,23,24)(H,21,22,25)/b20-10-/t15-/m0/s1 |
| InChIKey | DBWBGMDXNDZQEI-ANQVYJHKSA-N |
| XLogP | 2.52 |
| TPSA | 130.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.43 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|