C24H16ClN3O2S — CID 135521991
5-[2-(4-chlorophenyl)-2-oxoethyl]-2-(fluoren-9-ylidenehydrazinylidene)-1,3-thiazolidin-4-one (PubChem CID 135521991) has the molecular formula C24H16ClN3O2S and a molecular weight of 445.93 g/mol. Its IUPAC name is 5-[2-(4-chlorophenyl)-2-oxoethyl]-2-(fluoren-9-ylidenehydrazinylidene)-1,3-thiazolidin-4-one.
| Compound Name | 5-[2-(4-chlorophenyl)-2-oxoethyl]-2-(fluoren-9-ylidenehydrazinylidene)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135521991 |
| Molecular Formula | C24H16ClN3O2S |
| Molecular Weight | 445.93 g/mol |
| Exact Mass | 445.07 |
| IUPAC Name | 5-[2-(4-chlorophenyl)-2-oxoethyl]-2-(fluoren-9-ylidenehydrazinylidene)-1,3-thiazolidin-4-one |
| SMILES | O=C(CC1SC(=NN=C2c3ccccc3-c3ccccc32)NC1=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H16ClN3O2S/c25-15-11-9-14(10-12-15)20(29)13-21-23(30)26-24(31-21)28-27-22-18-7-3-1-5-16(18)17-6-2-4-8-19(17)22/h1-12,21H,13H2,(H,26,28,30) |
| InChIKey | UUFIGRGWTKAUJU-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 70.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.93 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|