C20H16BrN3O2S — CID 135626186
(2E)-5-[2-(4-bromophenyl)-2-oxoethyl]-2-(cinnamylidenehydrazinylidene)-1,3-thiazolidin-4-one (PubChem CID 135626186) has the molecular formula C20H16BrN3O2S and a molecular weight of 442.34 g/mol. Its IUPAC name is (2E)-5-[2-(4-bromophenyl)-2-oxoethyl]-2-(cinnamylidenehydrazinylidene)-1,3-thiazolidin-4-one.
| Compound Name | (2E)-5-[2-(4-bromophenyl)-2-oxoethyl]-2-(cinnamylidenehydrazinylidene)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135626186 |
| Molecular Formula | C20H16BrN3O2S |
| Molecular Weight | 442.34 g/mol |
| Exact Mass | 441.01 |
| IUPAC Name | (2E)-5-[2-(4-bromophenyl)-2-oxoethyl]-2-(cinnamylidenehydrazinylidene)-1,3-thiazolidin-4-one |
| SMILES | O=C(CC1S/C(=N/N=CC=Cc2ccccc2)NC1=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C20H16BrN3O2S/c21-16-10-8-15(9-11-16)17(25)13-18-19(26)23-20(27-18)24-22-12-4-7-14-5-2-1-3-6-14/h1-12,18H,13H2,(H,23,24,26) |
| InChIKey | CBHOOEVNTPXVEI-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 70.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.34 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_imine_B(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|