C21H18ClN3O2S — CID 136694759
(2Z,5R)-5-[2-(4-chloro-3-methylphenyl)-2-oxoethyl]-2-[(Z)-[(E)-3-phenylprop-2-enylidene]hydrazinylidene]-1,3-thiazolidin-4-one (PubChem CID 136694759) has the molecular formula C21H18ClN3O2S and a molecular weight of 411.91 g/mol. Its IUPAC name is (2Z,5R)-5-[2-(4-chloro-3-methylphenyl)-2-oxoethyl]-2-[(Z)-[(E)-3-phenylprop-2-enylidene]hydrazinylidene]-1,3-thiazolidin-4-one.
| Compound Name | (2Z,5R)-5-[2-(4-chloro-3-methylphenyl)-2-oxoethyl]-2-[(Z)-[(E)-3-phenylprop-2-enylidene]hydrazinylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 136694759 |
| Molecular Formula | C21H18ClN3O2S |
| Molecular Weight | 411.91 g/mol |
| Exact Mass | 411.08 |
| IUPAC Name | (2Z,5R)-5-[2-(4-chloro-3-methylphenyl)-2-oxoethyl]-2-[(Z)-[(E)-3-phenylprop-2-enylidene]hydrazinylidene]-1,3-thiazolidin-4-one |
| SMILES | Cc1cc(C(=O)C[C@H]2S/C(=N\N=C/C=C/c3ccccc3)NC2=O)ccc1Cl |
| InChI | InChI=1S/C21H18ClN3O2S/c1-14-12-16(9-10-17(14)22)18(26)13-19-20(27)24-21(28-19)25-23-11-5-8-15-6-3-2-4-7-15/h2-12,19H,13H2,1H3,(H,24,25,27)/b8-5+,23-11-/t19-/m1/s1 |
| InChIKey | JNIKUVMETDHLNM-NSELNCIGSA-N |
| XLogP | 4.51 |
| TPSA | 70.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.91 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_imine_B(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|