C20H16Cl2N4O2S — CID 135512674
2-[2-(cinnamylidenehydrazinylidene)-4-oxo-1,3-thiazolidin-5-yl]-N-(3,4-dichlorophenyl)acetamide (PubChem CID 135512674) has the molecular formula C20H16Cl2N4O2S and a molecular weight of 447.35 g/mol. Its IUPAC name is 2-[2-(cinnamylidenehydrazinylidene)-4-oxo-1,3-thiazolidin-5-yl]-N-(3,4-dichlorophenyl)acetamide.
| Compound Name | 2-[2-(cinnamylidenehydrazinylidene)-4-oxo-1,3-thiazolidin-5-yl]-N-(3,4-dichlorophenyl)acetamide |
|---|---|
| PubChem CID | 135512674 |
| Molecular Formula | C20H16Cl2N4O2S |
| Molecular Weight | 447.35 g/mol |
| Exact Mass | 446.04 |
| IUPAC Name | 2-[2-(cinnamylidenehydrazinylidene)-4-oxo-1,3-thiazolidin-5-yl]-N-(3,4-dichlorophenyl)acetamide |
| SMILES | O=C(CC1SC(=NN=CC=Cc2ccccc2)NC1=O)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C20H16Cl2N4O2S/c21-15-9-8-14(11-16(15)22)24-18(27)12-17-19(28)25-20(29-17)26-23-10-4-7-13-5-2-1-3-6-13/h1-11,17H,12H2,(H,24,27)(H,25,26,28) |
| InChIKey | ZVFZCPZCPHBJJD-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 82.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.35 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_imine_B(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|